EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H25Cl2F6N3O3 |
| Net Charge | 0 |
| Average Mass | 624.409 |
| Monoisotopic Mass | 623.11772 |
| SMILES | CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H](/C=C/C(=O)N[C@@H]1CCCCNC1=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H25Cl2F6N3O3/c1-38(25(41)16-12-17(26(30,31)32)14-18(13-16)27(33,34)35)19(10-15-5-7-20(28)21(29)11-15)6-8-23(39)37-22-4-2-3-9-36-24(22)40/h5-8,11-14,19,22H,2-4,9-10H2,1H3,(H,36,40)(H,37,39)/b8-6+/t19-,22+/m0/s1 |
| InChIKey | BHCJHYIMNHXLOM-WVDRJWPYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dnk333 (CHEBI:748440) has role antispasmodic drug (CHEBI:53784) |
| dnk333 (CHEBI:748440) has role dermatologic drug (CHEBI:50177) |
| dnk333 (CHEBI:748440) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| Dnk333 | ChEMBL |
| Citations |
|---|