EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H25Cl2F6N3O3 |
| Net Charge | 0 |
| Average Mass | 624.409 |
| Monoisotopic Mass | 623.11772 |
| SMILES | CN(C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H](/C=C/C(=O)N[C@@H]1CCCCNC1=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H25Cl2F6N3O3/c1-38(25(41)16-12-17(26(30,31)32)14-18(13-16)27(33,34)35)19(10-15-5-7-20(28)21(29)11-15)6-8-23(39)37-22-4-2-3-9-36-24(22)40/h5-8,11-14,19,22H,2-4,9-10H2,1H3,(H,36,40)(H,37,39)/b8-6+/t19-,22+/m0/s1 |
| InChIKey | BHCJHYIMNHXLOM-WVDRJWPYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dnk333 (CHEBI:748440) has role antispasmodic drug (CHEBI:53784) |
| dnk333 (CHEBI:748440) has role dermatologic drug (CHEBI:50177) |
| dnk333 (CHEBI:748440) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| Dnk333 | ChEMBL |
| Citations |
|---|