EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O10 |
| Net Charge | 0 |
| Average Mass | 418.354 |
| Monoisotopic Mass | 418.09000 |
| SMILES | COC(=O)c1cc(OC)c2c(c1-c1c(C(=O)OC)cc(OC)c3c1OCO3)OCO2 |
| InChI | InChI=1S/C20H18O10/c1-23-11-5-9(19(21)25-3)13(17-15(11)27-7-29-17)14-10(20(22)26-4)6-12(24-2)16-18(14)30-8-28-16/h5-6H,7-8H2,1-4H3 |
| InChIKey | JMZOMFYRADAWOG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antifibrotic agent Any agent which acts to reduce fibrosis. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bifendate (CHEBI:748434) has role antifibrotic agent (CHEBI:233423) |
| bifendate (CHEBI:748434) has role hepatoprotective agent (CHEBI:62868) |
| bifendate (CHEBI:748434) is a tannin (CHEBI:26848) |
| Synonyms | Source |
|---|---|
| .alpha.-ddb | ChEMBL |
| Bifendate | ChEMBL |
| Dimethyl dicarboxylate biphenyl | ChEMBL |
| Diphenyl dimethyl bicarboxylate | ChEMBL |
| Citations |
|---|