EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N2O3S2 |
| Net Charge | 0 |
| Average Mass | 340.470 |
| Monoisotopic Mass | 340.09153 |
| SMILES | COc1ccc2c(c1)N(C(=O)OC(C)C)[C@@H](CSC)C(=S)N2 |
| InChI | InChI=1S/C15H20N2O3S2/c1-9(2)20-15(18)17-12-7-10(19-3)5-6-11(12)16-14(21)13(17)8-22-4/h5-7,9,13H,8H2,1-4H3,(H,16,21)/t13-/m0/s1 |
| InChIKey | GWKIPRVERALPRD-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talviraline (CHEBI:748433) has role anti-HIV agent (CHEBI:64946) |
| talviraline (CHEBI:748433) is a methoxybenzenes (CHEBI:51683) |
| INNs | Source |
|---|---|
| talviralina | WHO MedNet |
| talviraline | WHO MedNet |
| Synonyms | Source |
|---|---|
| HBY 097 | ChEMBL |
| HBY-097 | ChEMBL |
| HBY097 | ChEMBL |
| Citations |
|---|