EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19ClFNO4 |
| Net Charge | 0 |
| Average Mass | 391.826 |
| Monoisotopic Mass | 391.09866 |
| SMILES | CC(=O)c1ccc2c(c1)[C@H](NC(=O)c1ccc(F)c(Cl)c1)[C@H](O)C(C)(C)O2 |
| InChI | InChI=1S/C20H19ClFNO4/c1-10(24)11-5-7-16-13(8-11)17(18(25)20(2,3)27-16)23-19(26)12-4-6-15(22)14(21)9-12/h4-9,17-18,25H,1-3H3,(H,23,26)/t17-,18-/m0/s1 |
| InChIKey | XLIIRNOPGJTBJD-ROUUACIJSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tonabersat (CHEBI:748421) has role anticoronaviral agent (CHEBI:149553) |
| tonabersat (CHEBI:748421) is a 1-benzopyran (CHEBI:38443) |
| INNs | Source |
|---|---|
| tonabersat | WHO MedNet |
| tonabersate | WHO MedNet |
| Synonym | Source |
|---|---|
| SB-220453 | ChEMBL |
| Citations |
|---|