EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N5O4P |
| Net Charge | 0 |
| Average Mass | 299.227 |
| Monoisotopic Mass | 299.07834 |
| SMILES | Nc1ncc2ncn(CC3(OCP(=O)(O)O)CC3)c2n1 |
| InChI | InChI=1S/C10H14N5O4P/c11-9-12-3-7-8(14-9)15(5-13-7)4-10(1-2-10)19-6-20(16,17)18/h3,5H,1-2,4,6H2,(H2,11,12,14)(H2,16,17,18) |
| InChIKey | KDNSSKPZBDNJDF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| besifovir (CHEBI:748416) has role anti-HBV agent (CHEBI:64951) |
| besifovir (CHEBI:748416) is a purines (CHEBI:26401) |
| Synonyms | Source |
|---|---|
| Besifovir | ChEMBL |
| Lb80331 | ChEMBL |
| Citations |
|---|