EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12Cl3N5O2 |
| Net Charge | 0 |
| Average Mass | 424.675 |
| Monoisotopic Mass | 423.00566 |
| SMILES | NC(=O)c1nnn(Cc2cc(Cl)c(C(=O)c3ccc(Cl)cc3)c(Cl)c2)c1N |
| InChI | InChI=1S/C17H12Cl3N5O2/c18-10-3-1-9(2-4-10)15(26)13-11(19)5-8(6-12(13)20)7-25-16(21)14(17(22)27)23-24-25/h1-6H,7,21H2,(H2,22,27) |
| InChIKey | WNRZHQBJSXRYJK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboxyamidotriazole (CHEBI:748414) has role antineoplastic agent (CHEBI:35610) |
| carboxyamidotriazole (CHEBI:748414) is a benzophenones (CHEBI:22726) |
| Synonyms | Source |
|---|---|
| Carboxyamidotriazole | ChEMBL |
| L 651582 | ChEMBL |
| NSC-609974 | ChEMBL |
| Citations |
|---|