EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C20H21NO4 |
| Net Charge | 0 |
| Average Mass | 375.852 |
| Monoisotopic Mass | 375.12374 |
| SMILES | COc1ccc(Cc2nccc3cc(OC)c(OC)cc23)cc1OC.Cl |
| InChI | InChI=1S/C20H21NO4.ClH/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16;/h5-8,10-12H,9H2,1-4H3;1H |
| InChIKey | UOTMYNBWXDUBNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| papaverine hydrochloride (CHEBI:748411) has role antineoplastic agent (CHEBI:35610) |
| papaverine hydrochloride (CHEBI:748411) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| Artegodan | ChEMBL |
| Cardoverina | ChEMBL |
| NSC-35443 | ChEMBL |
| Papaverini hydrochloridum | ChEMBL |
| Vasorin | ChEMBL |
| Brand Name | Source |
|---|---|
| Papaver hcl | ChEMBL |
| Citations |
|---|