EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748407 - k-777
| Formula | C32H38N4O4S |
| Net Charge | 0 |
| Average Mass | 574.747 |
| Monoisotopic Mass | 574.26138 |
| SMILES | CN1CCN(C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](/C=C/S(=O)(=O)c2ccccc2)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H38N4O4S/c1-35-20-22-36(23-21-35)32(38)34-30(25-27-13-7-3-8-14-27)31(37)33-28(18-17-26-11-5-2-6-12-26)19-24-41(39,40)29-15-9-4-10-16-29/h2-16,19,24,28,30H,17-18,20-23,25H2,1H3,(H,33,37)(H,34,38)/b24-19+/t28-,30-/m0/s1 |
| InChIKey | RHJLQMVZXQKJKB-FPHSVDBKSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| k-777 (CHEBI:748407) has role antiviral agent (CHEBI:22587) |
| k-777 (CHEBI:748407) is a phenylalanine derivative (CHEBI:25985) |
| Synonyms | Source |
|---|---|
| APC-3316 | ChEMBL |
| APC3316 | ChEMBL |
| CRA-3316 | ChEMBL |
| CRA3316 | ChEMBL |
| K-1177 | ChEMBL |
| K1177 | ChEMBL |
| Citations |
|---|