EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748402 - nimidane
| Formula | C9H8ClNS2 |
| Net Charge | 0 |
| Average Mass | 229.757 |
| Monoisotopic Mass | 228.97867 |
| SMILES | Cc1cc(Cl)ccc1N=C1SCS1 |
| InChI | InChI=1S/C9H8ClNS2/c1-6-4-7(10)2-3-8(6)11-9-12-5-13-9/h2-4H,5H2,1H3 |
| InChIKey | XYJUOQPINFXBEZ-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nimidane (CHEBI:748402) is a organochlorine compound (CHEBI:36683) |
| INNs | Source |
|---|---|
| nimidane | WHO MedNet |
| nimidano | WHO MedNet |
| Synonyms | Source |
|---|---|
| CL 84,633 | ChEMBL |
| CL-84633 | ChEMBL |
| ENT 29,106 | ChEMBL |
| ENT-29106 | ChEMBL |
| Citations |
|---|