EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H28N4O3 |
| Net Charge | 0 |
| Average Mass | 468.557 |
| Monoisotopic Mass | 468.21614 |
| SMILES | CN(C)C[C@@H]1CCn2cc(c3ccccc32)C2=C(C(=O)NC2=O)c2cn(c3ccccc23)CCO1 |
| InChI | InChI=1S/C28H28N4O3/c1-30(2)15-18-11-12-31-16-21(19-7-3-5-9-23(19)31)25-26(28(34)29-27(25)33)22-17-32(13-14-35-18)24-10-6-4-8-20(22)24/h3-10,16-18H,11-15H2,1-2H3,(H,29,33,34)/t18-/m0/s1 |
| InChIKey | ZCBUQCWBWNUWSU-SFHVURJKSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ruboxistaurin (CHEBI:748391) has role cardiovascular drug (CHEBI:35554) |
| ruboxistaurin (CHEBI:748391) has role hypoglycemic agent (CHEBI:35526) |
| ruboxistaurin (CHEBI:748391) is a indoles (CHEBI:24828) |
| INNs | Source |
|---|---|
| ruboxistaurin | WHO MedNet |
| ruboxistaurina | WHO MedNet |
| ruboxistaurine | WHO MedNet |
| Synonym | Source |
|---|---|
| Ly-333531 | ChEMBL |
| Brand Name | Source |
|---|---|
| Arxxant | ChEMBL |
| Citations |
|---|