EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23NO3 |
| Net Charge | 0 |
| Average Mass | 361.441 |
| Monoisotopic Mass | 361.16779 |
| SMILES | O=C(O)[C@@H](c1ccc(OCc2ccc3ccccc3n2)cc1)C1CCCC1 |
| InChI | InChI=1S/C23H23NO3/c25-23(26)22(17-6-1-2-7-17)18-10-13-20(14-11-18)27-15-19-12-9-16-5-3-4-8-21(16)24-19/h3-5,8-14,17,22H,1-2,6-7,15H2,(H,25,26)/t22-/m1/s1 |
| InChIKey | ZEYYDOLCHFETHQ-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| veliflapon (CHEBI:748389) has role cardiovascular drug (CHEBI:35554) |
| veliflapon (CHEBI:748389) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| veliflapon | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY-X-005 | ChEMBL |
| BAY X 1005 | ChEMBL |
| BAY X-1005 | ChEMBL |
| BAY-X-1005 | ChEMBL |
| DG-031 | ChEMBL |
| Citations |
|---|