EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cl.C38H28N8.Cl |
| Net Charge | 0 |
| Average Mass | 667.604 |
| Monoisotopic Mass | 666.18140 |
| SMILES | [Cl-].[Cl-].c1ccc(-c2nn(-c3ccccc3)[n+](-c3ccc(-c4ccc(-[n+]5nc(-c6ccccc6)nn5-c5ccccc5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C38H28N8.2ClH/c1-5-13-31(14-6-1)37-39-43(33-17-9-3-10-18-33)45(41-37)35-25-21-29(22-26-35)30-23-27-36(28-24-30)46-42-38(32-15-7-2-8-16-32)40-44(46)34-19-11-4-12-20-34;;/h1-28H;2*1H/q+2;;/p-2 |
| InChIKey | WYFYSTBFFDOVJW-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neotetrazolium chloride (CHEBI:748374) has role antineoplastic agent (CHEBI:35610) |
| neotetrazolium chloride (CHEBI:748374) is a benzenes (CHEBI:22712) |
| Synonyms | Source |
|---|---|
| Neo-t | ChEMBL |
| Neotetrazolium blue | ChEMBL |
| Neotetrazolium chloride | ChEMBL |
| NSC-27621 | ChEMBL |
| Citations |
|---|