EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10N2.HCl |
| Net Charge | 0 |
| Average Mass | 230.698 |
| Monoisotopic Mass | 230.06108 |
| SMILES | Cl.Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C13H10N2.ClH/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;/h1-8H,(H2,14,15);1H |
| InChIKey | FTGPOQQGJVJDCT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Applications: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-aminoacridine hydrochloride (CHEBI:74837) has part 9-aminoacridine(1+) (CHEBI:74835) |
| 9-aminoacridine hydrochloride (CHEBI:74837) has role antiinfective agent (CHEBI:35441) |
| 9-aminoacridine hydrochloride (CHEBI:74837) has role antiseptic drug (CHEBI:48218) |
| 9-aminoacridine hydrochloride (CHEBI:74837) has role mutagen (CHEBI:25435) |
| 9-aminoacridine hydrochloride (CHEBI:74837) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 9-aminoacridinium chloride |
| acridin-9-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 9-acridinamine HCl | ChEBI |
| 9-acridinamine monohydrochloride | ChemIDplus |
| 9-aminoacridine HCl | ChEBI |
| 9-aminoacridine monohydrochloride | ChEBI |
| Acramine Yellow | ChemIDplus |
| aminacrine HCl | ChEBI |
| Brand Name | Source |
|---|---|
| Monacrin | KEGG DRUG |
| Citations |
|---|