EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11N5O |
| Net Charge | 0 |
| Average Mass | 241.254 |
| Monoisotopic Mass | 241.09636 |
| SMILES | Nc1nc(=O)c2ncc(Cc3cccnc3)c2n1 |
| InChI | InChI=1S/C12H11N5O/c13-12-16-9-8(4-7-2-1-3-14-5-7)6-15-10(9)11(18)17-12/h1-3,5-6,15H,4H2,(H3,13,16,17,18) |
| InChIKey | DOHVAKFYAHLCJP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peldesine (CHEBI:748355) has role anti-HIV agent (CHEBI:64946) |
| peldesine (CHEBI:748355) is a pyrrolopyrimidine (CHEBI:38670) |
| INNs | Source |
|---|---|
| peldesina | WHO MedNet |
| peldesine | WHO MedNet |
| Synonym | Source |
|---|---|
| BCX-34 | ChEMBL |
| Citations |
|---|