EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20ClNO6S |
| Net Charge | 0 |
| Average Mass | 425.890 |
| Monoisotopic Mass | 425.06999 |
| SMILES | O=C(NO)C1(CS(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C19H20ClNO6S/c20-14-1-3-15(4-2-14)27-16-5-7-17(8-6-16)28(24,25)13-19(18(22)21-23)9-11-26-12-10-19/h1-8,23H,9-13H2,(H,21,22) |
| InChIKey | ROSNVSQTEGHUKU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cts-1027 (CHEBI:748351) has role antiviral agent (CHEBI:22587) |
| cts-1027 (CHEBI:748351) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Cts-1027 | ChEMBL |
| RO-1130830 | ChEMBL |
| RS-130830 | ChEMBL |
| Citations |
|---|