EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12Cl2N2O4S |
| Net Charge | 0 |
| Average Mass | 387.244 |
| Monoisotopic Mass | 385.98948 |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NS(=O)(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C15H12Cl2N2O4S/c16-12-3-1-10(8-13(12)17)18-15(20)19-24(21,22)11-2-4-14-9(7-11)5-6-23-14/h1-4,7-8H,5-6H2,(H2,18,19,20) |
| InChIKey | VAMFSFIPDOODFH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ly-295501 (CHEBI:748342) has role antineoplastic agent (CHEBI:35610) |
| ly-295501 (CHEBI:748342) is a ureas (CHEBI:47857) |
| Synonyms | Source |
|---|---|
| ILX-295501 | ChEMBL |
| Ly-295501 | ChEMBL |
| LY295501 | ChEMBL |
| Citations |
|---|