EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28FNO3 |
| Net Charge | 0 |
| Average Mass | 373.468 |
| Monoisotopic Mass | 373.20532 |
| SMILES | COc1cccc([C@H](O)C2CCN(CCc3ccc(F)cc3)CC2)c1OC |
| InChI | InChI=1S/C22H28FNO3/c1-26-20-5-3-4-19(22(20)27-2)21(25)17-11-14-24(15-12-17)13-10-16-6-8-18(23)9-7-16/h3-9,17,21,25H,10-15H2,1-2H3/t21-/m1/s1 |
| InChIKey | HXTGXYRHXAGCFP-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| volinanserin (CHEBI:748341) has role antidepressant (CHEBI:35469) |
| volinanserin (CHEBI:748341) is a dimethoxybenzene (CHEBI:51681) |
| INNs | Source |
|---|---|
| volinanserin | WHO MedNet |
| volinanserina | WHO MedNet |
| volinanserine | WHO MedNet |
| Synonyms | Source |
|---|---|
| M-100907 | ChEMBL |
| M100907 | ChEMBL |
| MDL-100.907 | ChEMBL |
| MDL-100907 | ChEMBL |
| MDL100.907 | ChEMBL |
| Citations |
|---|