EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H41N5O5S |
| Net Charge | 0 |
| Average Mass | 499.678 |
| Monoisotopic Mass | 499.28284 |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](S)CCN1C(=O)N(C)C(C)(C)C1=O)C(C)(C)C |
| InChI | InChI=1S/C23H41N5O5S/c1-13(2)12-14(17(29)26-16(19(31)24-8)22(3,4)5)25-18(30)15(34)10-11-28-20(32)23(6,7)27(9)21(28)33/h13-16,34H,10-12H2,1-9H3,(H,24,31)(H,25,30)(H,26,29)/t14-,15-,16+/m0/s1 |
| InChIKey | GTXSRFUZSLTDFX-HRCADAONSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rebimastat (CHEBI:748339) has role antineoplastic agent (CHEBI:35610) |
| rebimastat (CHEBI:748339) is a dipeptide (CHEBI:46761) |
| INN | Source |
|---|---|
| rebimastat | WHO MedNet |
| Synonyms | Source |
|---|---|
| BMS-275291 | ChEMBL |
| BMS 275291-01 | ChEMBL |
| BMS-275291-01 | ChEMBL |
| D-2163 | ChEMBL |
| D2163 | ChEMBL |
| Citations |
|---|