EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O2 |
| Net Charge | 0 |
| Average Mass | 352.518 |
| Monoisotopic Mass | 352.24023 |
| SMILES | [H][C@@]1(/C=C/C(C)=C/C(=O)O)C[C@]1(C)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H32O2/c1-16(13-21(25)26)7-8-18-15-24(18,6)17-9-10-19-20(14-17)23(4,5)12-11-22(19,2)3/h7-10,13-14,18H,11-12,15H2,1-6H3,(H,25,26)/b8-7+,16-13+/t18-,24-/m1/s1 |
| InChIKey | BOOOLEGQBVUTKC-NVQSDHBMSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irx-4204 (CHEBI:748338) has role antineoplastic agent (CHEBI:35610) |
| irx-4204 (CHEBI:748338) has role antiparkinson drug (CHEBI:48407) |
| irx-4204 (CHEBI:748338) is a tetralins (CHEBI:36786) |
| Synonyms | Source |
|---|---|
| AGN-194204 | ChEMBL |
| AGN194204 | ChEMBL |
| Irx-4204 | ChEMBL |
| KB-145960 | ChEMBL |
| NRX-194204 | ChEMBL |
| NRX194204 | ChEMBL |
| Citations |
|---|