EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748328 - dapivirine
| Formula | C20H19N5 |
| Net Charge | 0 |
| Average Mass | 329.407 |
| Monoisotopic Mass | 329.16405 |
| SMILES | Cc1cc(C)c(Nc2ccnc(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C20H19N5/c1-13-10-14(2)19(15(3)11-13)24-18-8-9-22-20(25-18)23-17-6-4-16(12-21)5-7-17/h4-11H,1-3H3,(H2,22,23,24,25) |
| InChIKey | ILAYIAGXTHKHNT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dapivirine (CHEBI:748328) has role anti-HIV agent (CHEBI:64946) |
| dapivirine (CHEBI:748328) has role antiinfective agent (CHEBI:35441) |
| dapivirine (CHEBI:748328) is a benzenes (CHEBI:22712) |
| dapivirine (CHEBI:748328) is a nitrile (CHEBI:18379) |
| INN | Source |
|---|---|
| dapivirina | WHO MedNet |
| Synonyms | Source |
|---|---|
| AIDS-105293 | ChEMBL |
| Dapivirine | ChEMBL |
| Gel-02 | ChEMBL |
| R-147681 | ChEMBL |
| Tmc120 | ChEMBL |
| TMC-120 | ChEMBL |
| Citations |
|---|