EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30N4O6 |
| Net Charge | 0 |
| Average Mass | 518.570 |
| Monoisotopic Mass | 518.21653 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2CN1CCN(C)CC1)OCCO3 |
| InChI | InChI=1S/C28H30N4O6/c1-3-28(35)20-11-22-25-18(14-32(22)26(33)19(20)15-38-27(28)34)17(13-31-6-4-30(2)5-7-31)16-10-23-24(12-21(16)29-25)37-9-8-36-23/h10-12,35H,3-9,13-15H2,1-2H3/t28-/m0/s1 |
| InChIKey | RVFGKBWWUQOIOU-NDEPHWFRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lurtotecan (CHEBI:748323) has role antineoplastic agent (CHEBI:35610) |
| lurtotecan (CHEBI:748323) is a pyranoindolizinoquinoline (CHEBI:48626) |
| INN | Source |
|---|---|
| lurtotecan | WHO MedNet |
| Citations |
|---|