EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14N4O6 |
| Net Charge | 0 |
| Average Mass | 394.343 |
| Monoisotopic Mass | 394.09133 |
| SMILES | O=[N+]([O-])c1ccc(NN=C(c2ccc(O)cc2)c2ccc(O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14N4O6/c24-15-6-1-12(2-7-15)19(13-3-8-16(25)9-4-13)21-20-17-10-5-14(22(26)27)11-18(17)23(28)29/h1-11,20,24-25H |
| InChIKey | YOQPCWIXYUNEET-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sivifene (CHEBI:748316) has role antineoplastic agent (CHEBI:35610) |
| sivifene (CHEBI:748316) is a diarylmethane (CHEBI:51614) |
| INNs | Source |
|---|---|
| sivifene | WHO MedNet |
| sivifeno | WHO MedNet |
| Synonym | Source |
|---|---|
| A-007 | ChEMBL |
| Citations |
|---|