EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | K.C22H22ClN6O |
| Net Charge | 0 |
| Average Mass | 461.010 |
| Monoisotopic Mass | 460.11807 |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nnn[n-]2)cc1.[K+] |
| InChI | InChI=1S/C22H22ClN6O.K/c1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22;/h4-7,9-12,30H,2-3,8,13-14H2,1H3;/q-1;+1 |
| InChIKey | OXCMYAYHXIHQOA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| losartan potassium (CHEBI:748315) has role antihypertensive agent (CHEBI:35674) |
| losartan potassium (CHEBI:748315) has role nephroprotective agent (CHEBI:76595) |
| losartan potassium (CHEBI:748315) has role renoprotective agent (CHEBI:231911) |
| losartan potassium (CHEBI:748315) is a imidazoles (CHEBI:24780) |
| Synonyms | Source |
|---|---|
| Aradois | ChEMBL |
| DUP 753 | ChEMBL |
| DUP-753 | ChEMBL |
| DUP753 | ChEMBL |
| DU PONT-753 | ChEMBL |
| E-3340 | ChEMBL |
| Brand Names | Source |
|---|---|
| Cozaar | ChEMBL |
| Losaprex | ChEMBL |
| Losartan potassium component of hyzaar | ChEMBL |
| Citations |
|---|