EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O6S |
| Net Charge | 0 |
| Average Mass | 288.281 |
| Monoisotopic Mass | 288.04161 |
| SMILES | [H][C@]12SC(COC(N)=O)=C(C(=O)O)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C10H12N2O6S/c1-3(13)5-7(14)12-6(9(15)16)4(19-8(5)12)2-18-10(11)17/h3,5,8,13H,2H2,1H3,(H2,11,17)(H,15,16)/t3-,5+,8-/m1/s1 |
| InChIKey | IKQNRQOUOZJHTR-UWBRJAPDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ritipenem (CHEBI:748312) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| ritipenem | WHO MedNet |
| Citations |
|---|