EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748303 - mifentidine
| Formula | C13H16N4 |
| Net Charge | 0 |
| Average Mass | 228.299 |
| Monoisotopic Mass | 228.13750 |
| SMILES | CC(C)/N=C/Nc1ccc(-c2cncn2)cc1 |
| InChI | InChI=1S/C13H16N4/c1-10(2)15-9-16-12-5-3-11(4-6-12)13-7-14-8-17-13/h3-10H,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | GOZUADYOHPCXLE-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mifentidine (CHEBI:748303) is a imidazoles (CHEBI:24780) |
| INNs | Source |
|---|---|
| mifentidina | WHO MedNet |
| mifentidine | WHO MedNet |
| Citations |
|---|