EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19BN2O3 |
| Net Charge | 0 |
| Average Mass | 214.074 |
| Monoisotopic Mass | 214.14887 |
| SMILES | CC(C)[C@H](N)C(=O)N1CCC[C@H]1B(O)O |
| InChI | InChI=1S/C9H19BN2O3/c1-6(2)8(11)9(13)12-5-3-4-7(12)10(14)15/h6-8,14-15H,3-5,11H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | FKCMADOPPWWGNZ-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talabostat (CHEBI:748301) has role antineoplastic agent (CHEBI:35610) |
| talabostat (CHEBI:748301) is a valine derivative (CHEBI:27267) |
| Synonym | Source |
|---|---|
| Valinyl-l-boroproline | ChEMBL |
| Citations |
|---|