EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClN2O3 |
| Net Charge | 0 |
| Average Mass | 342.782 |
| Monoisotopic Mass | 342.07712 |
| SMILES | O=C(N[C@@H](Cc1cnc2ccccc12)C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN2O3/c19-13-7-5-11(6-8-13)17(22)21-16(18(23)24)9-12-10-20-15-4-2-1-3-14(12)15/h1-8,10,16,20H,9H2,(H,21,22)(H,23,24)/t16-/m0/s1 |
| InChIKey | QJERBBQXOMUURJ-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzotript (CHEBI:748293) is a N-acylglycine (CHEBI:16180) |
| INNs | Source |
|---|---|
| benzotript | WHO MedNet |
| benzotripte | WHO MedNet |
| benzotripto | WHO MedNet |
| Synonym | Source |
|---|---|
| N-(p-chlorobenzoyl)-l-tryptophan | ChEMBL |
| Citations |
|---|