EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O4 |
| Net Charge | 0 |
| Average Mass | 240.214 |
| Monoisotopic Mass | 240.04226 |
| SMILES | CC(=O)c1cc2c(o1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H8O4/c1-7(15)11-6-10-12(16)8-4-2-3-5-9(8)13(17)14(10)18-11/h2-6H,1H3 |
| InChIKey | DPHUWDIXHNQOSY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| napabucasin (CHEBI:748285) has role antineoplastic agent (CHEBI:35610) |
| napabucasin (CHEBI:748285) is a naphthofuran (CHEBI:39270) |
| INNs | Source |
|---|---|
| napabucasin | WHO MedNet |
| napabucasina | WHO MedNet |
| napabucasine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-acetylfuranonaphthoquinone | ChEMBL |
| 2-acetylfuro-1,4-naphthoquinone | ChEMBL |
| BBI-608 | ChEMBL |
| BBI608 | ChEMBL |
| Citations |
|---|