EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H27N9O6S |
| Net Charge | 0 |
| Average Mass | 605.637 |
| Monoisotopic Mass | 605.18050 |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccnc(-c3nnnn3)c2)nc1OCCO |
| InChI | InChI=1S/C27H27N9O6S/c1-16(2)18-8-9-22(29-15-18)43(38,39)34-26-23(42-21-7-5-4-6-20(21)40-3)27(41-13-12-37)31-24(30-26)17-10-11-28-19(14-17)25-32-35-36-33-25/h4-11,14-16,37H,12-13H2,1-3H3,(H,30,31,34)(H,32,33,35,36) |
| InChIKey | TUYWTLTWNJOZNY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tezosentan (CHEBI:748280) has role antihypertensive agent (CHEBI:35674) |
| tezosentan (CHEBI:748280) has role cardiovascular drug (CHEBI:35554) |
| tezosentan (CHEBI:748280) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| tezosentan | WHO MedNet |
| Synonyms | Source |
|---|---|
| ACT-050089 | ChEMBL |
| Ro 61-0612 | ChEMBL |
| Ro-610612 | ChEMBL |
| Brand Name | Source |
|---|---|
| Veletri | ChEMBL |
| Citations |
|---|