EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15FN2O2S |
| Net Charge | 0 |
| Average Mass | 318.373 |
| Monoisotopic Mass | 318.08383 |
| SMILES | C[C@H](C#Cc1ccc(Cc2ccc(F)cc2)s1)N(O)C(N)=O |
| InChI | InChI=1S/C16H15FN2O2S/c1-11(19(21)16(18)20)2-7-14-8-9-15(22-14)10-12-3-5-13(17)6-4-12/h3-6,8-9,11,21H,10H2,1H3,(H2,18,20)/t11-/m1/s1 |
| InChIKey | MMSNEKOTSJRTRI-LLVKDONJSA-N |
| Roles Classification |
|---|
| Applications: | antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atreleuton (CHEBI:748279) has role antiatherosclerotic agent (CHEBI:145947) |
| atreleuton (CHEBI:748279) has role cardiovascular drug (CHEBI:35554) |
| atreleuton (CHEBI:748279) is a organofluorine compound (CHEBI:37143) |
| INN | Source |
|---|---|
| atreleuton | WHO MedNet |
| Synonyms | Source |
|---|---|
| A-85761 | ChEMBL |
| A-85761.0 | ChEMBL |
| ABBOTT-85761 | ChEMBL |
| ABT-761 | ChEMBL |
| VIA-2291 | ChEMBL |
| Citations |
|---|