EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748267 - sitamaquine
| Formula | C21H33N3O |
| Net Charge | 0 |
| Average Mass | 343.515 |
| Monoisotopic Mass | 343.26236 |
| SMILES | CCN(CC)CCCCCCNc1cc(OC)cc2c(C)ccnc12 |
| InChI | InChI=1S/C21H33N3O/c1-5-24(6-2)14-10-8-7-9-12-22-20-16-18(25-4)15-19-17(3)11-13-23-21(19)20/h11,13,15-16,22H,5-10,12,14H2,1-4H3 |
| InChIKey | RVAKDGYPIVSYEU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sitamaquine (CHEBI:748267) has role antileishmanial agent (CHEBI:70868) |
| sitamaquine (CHEBI:748267) is a quinolines (CHEBI:26513) |
| INNs | Source |
|---|---|
| sitamaquina | WHO MedNet |
| sitamaquine | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-2452 | ChEMBL |
| Sitamaquine dihydrochloride | ChEMBL |
| WR-6026 | ChEMBL |
| Citations |
|---|