EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H49N9O5 |
| Net Charge | 0 |
| Average Mass | 711.868 |
| Monoisotopic Mass | 711.38567 |
| SMILES | CC(C)(N)C(=O)N[C@@H](Cc1cncn1)C(=O)N[C@H](Cc1ccc2ccccc2c1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C38H49N9O5/c1-38(2,41)37(52)47-32(21-28-22-42-23-43-28)36(51)46-31(20-25-15-16-26-12-6-7-13-27(26)18-25)35(50)45-30(19-24-10-4-3-5-11-24)34(49)44-29(33(40)48)14-8-9-17-39/h3-7,10-13,15-16,18,22-23,29-32H,8-9,14,17,19-21,39,41H2,1-2H3,(H2,40,48)(H,42,43)(H,44,49)(H,45,50)(H,46,51)(H,47,52)/t29-,30+,31+,32-/m0/s1 |
| InChIKey | NEHWBYHLYZGBNO-BVEPWEIPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ipamorelin (CHEBI:748259) has role gastrointestinal drug (CHEBI:55324) |
| ipamorelin (CHEBI:748259) is a polypeptide (CHEBI:15841) |
| INNs | Source |
|---|---|
| ipamorelin | WHO MedNet |
| ipamorelina | WHO MedNet |
| ipamoreline | WHO MedNet |
| Synonyms | Source |
|---|---|
| Aib-his-d-2-nal-d-phe-lys-nh2 | ChEMBL |
| NNC 26-0161 | ChEMBL |
| NNC-26-0161 | ChEMBL |
| NNC-260161 | ChEMBL |
| Citations |
|---|