EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748254 - uc 781
| Formula | C17H18ClNO2S |
| Net Charge | 0 |
| Average Mass | 335.856 |
| Monoisotopic Mass | 335.07468 |
| SMILES | CC(C)=CCOc1cc(NC(=S)c2ccoc2C)ccc1Cl |
| InChI | InChI=1S/C17H18ClNO2S/c1-11(2)6-8-21-16-10-13(4-5-15(16)18)19-17(22)14-7-9-20-12(14)3/h4-7,9-10H,8H2,1-3H3,(H,19,22) |
| InChIKey | YZHIXLCGPOTQNB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| uc 781 (CHEBI:748254) has role anti-HIV agent (CHEBI:64946) |
| uc 781 (CHEBI:748254) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Uc 781 | ChEMBL |
| UC-781 | ChEMBL |
| Citations |
|---|