EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C14H9N4O5 |
| Net Charge | 0 |
| Average Mass | 336.239 |
| Monoisotopic Mass | 336.04706 |
| SMILES | O=C1CN(/N=C/c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)C(=O)[N-]1.[Na+] |
| InChI | InChI=1S/C14H10N4O5.Na/c19-13-8-17(14(20)16-13)15-7-11-5-6-12(23-11)9-1-3-10(4-2-9)18(21)22;/h1-7H,8H2,(H,16,19,20);/q;+1/p-1/b15-7+; |
| InChIKey | KSRLIXGNPXAZHD-HAZZGOGXSA-M |
| Roles Classification |
|---|
| Biological Role: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Application: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dantrolene sodium (CHEBI:748253) has role immunosuppressive agent (CHEBI:35705) |
| dantrolene sodium (CHEBI:748253) is a imidazolidine-2,4-dione (CHEBI:24628) |
| Synonyms | Source |
|---|---|
| Dantamacrin | ChEMBL |
| Dantrolen | ChEMBL |
| Dantrolene sodium hemiheptahydrate | ChEMBL |
| Dantrolene sodium heptahydrate | ChEMBL |
| Dantrolene sodium hydrate | ChEMBL |
| Dantrolene sodium salt hemiheptahydrate | ChEMBL |
| Brand Names | Source |
|---|---|
| Agilus | ChEMBL |
| Revonto | ChEMBL |
| Ryanodex | ChEMBL |
| Citations |
|---|