EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21N5O4 |
| Net Charge | 0 |
| Average Mass | 275.309 |
| Monoisotopic Mass | 275.15935 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C10H21N5O4/c1-5(16)7(11)8(17)15-6(9(18)19)3-2-4-14-10(12)13/h5-7,16H,2-4,11H2,1H3,(H,15,17)(H,18,19)(H4,12,13,14)/t5-,6+,7+/m1/s1 |
| InChIKey | HYLXOQURIOCKIH-VQVTYTSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Arg (CHEBI:74825) has role metabolite (CHEBI:25212) |
| Thr-Arg (CHEBI:74825) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-arginine |
| Synonyms | Source |
|---|---|
| L-Thr-L-Arg | ChEBI |
| Threoninyl-Arginine | HMDB |
| threonylarginine | ChEBI |
| TR | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029055 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5756084 | Reaxys |