EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748248 - fosphenytoin sodium
| Formula | Na.C16H13N2O6P.Na |
| Net Charge | 0 |
| Average Mass | 406.242 |
| Monoisotopic Mass | 406.03066 |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1COP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C16H15N2O6P.2Na/c19-14-16(12-7-3-1-4-8-12,13-9-5-2-6-10-13)17-15(20)18(14)11-24-25(21,22)23;;/h1-10H,11H2,(H,17,20)(H2,21,22,23);;/q;2*+1/p-2 |
| InChIKey | GQPXYJNXTAFDLT-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosphenytoin sodium (CHEBI:748248) is a imidazolidine-2,4-dione (CHEBI:24628) |
| Synonyms | Source |
|---|---|
| ACC-9653-010 (SODIUM SALT) | ChEMBL |
| CI 982 | ChEMBL |
| CI-982 | ChEMBL |
| Fosphenytoin disodium salt | ChEMBL |
| Brand Names | Source |
|---|---|
| Pro-epanutin | ChEMBL |
| Sesquient | ChEMBL |
| Citations |
|---|