EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16N4O4 |
| Net Charge | 0 |
| Average Mass | 400.394 |
| Monoisotopic Mass | 400.11715 |
| SMILES | Cn1cc(C2=C(c3cn(C)c4cc([N+](=O)[O-])ccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C22H16N4O4/c1-24-10-15(13-5-3-4-6-17(13)24)19-20(22(28)23-21(19)27)16-11-25(2)18-9-12(26(29)30)7-8-14(16)18/h3-11H,1-2H3,(H,23,27,28) |
| InChIKey | OVSKGTONMLKNPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enmd-981693 (CHEBI:748247) has role antineoplastic agent (CHEBI:35610) |
| enmd-981693 (CHEBI:748247) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| Enmd-2076 free base | ChEMBL |
| Enmd-981693 | ChEMBL |
| ENMD 981693 | ChEMBL |
| Mkc 1 | ChEMBL |
| MKC-1 | ChEMBL |
| R-440 | ChEMBL |
| Citations |
|---|