EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O4 |
| Net Charge | 0 |
| Average Mass | 190.199 |
| Monoisotopic Mass | 190.09536 |
| SMILES | C[C@H](NC(=O)[C@@H](N)[C@@H](C)O)C(=O)O |
| InChI | InChI=1S/C7H14N2O4/c1-3(7(12)13)9-6(11)5(8)4(2)10/h3-5,10H,8H2,1-2H3,(H,9,11)(H,12,13)/t3-,4+,5-/m0/s1 |
| InChIKey | VPZKQTYZIVOJDV-LMVFSUKVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Ala (CHEBI:74824) has role metabolite (CHEBI:25212) |
| Thr-Ala (CHEBI:74824) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-alanine |
| Synonyms | Source |
|---|---|
| L-Thr-L-Ala | ChEBI |
| TA | ChEBI |
| Threoninyl-Alanine | HMDB |
| threonylalanine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029054 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4992791 | Reaxys |