EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O4 |
| Net Charge | 0 |
| Average Mass | 204.226 |
| Monoisotopic Mass | 204.11101 |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CO)C(=O)O |
| InChI | InChI=1S/C8H16N2O4/c1-4(2)6(8(13)14)10-7(12)5(9)3-11/h4-6,11H,3,9H2,1-2H3,(H,10,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | ILVGMCVCQBJPSH-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Val (CHEBI:74823) has role metabolite (CHEBI:25212) |
| Ser-Val (CHEBI:74823) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-seryl-L-valine |
| Synonyms | Source |
|---|---|
| Serinyl-Valine | HMDB |
| serylvaline | ChEBI |
| L-Ser-L-Val | ChEBI |
| SV | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029052 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6595936 | Reaxys |