EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6.C21H29NO2 |
| Net Charge | 0 |
| Average Mass | 477.554 |
| Monoisotopic Mass | 477.23627 |
| SMILES | O=C(O)C(O)C(O)C(=O)O.[H][C@@]12Cc3ccc(O)cc3[C@]3(CCCC[C@]31O)CCN2CC1CCC1 |
| InChI | InChI=1S/C21H29NO2.C4H6O6/c23-17-7-6-16-12-19-21(24)9-2-1-8-20(21,18(16)13-17)10-11-22(19)14-15-4-3-5-15;5-1(3(7)8)2(6)4(9)10/h6-7,13,15,19,23-24H,1-5,8-12,14H2;1-2,5-6H,(H,7,8)(H,9,10)/t19-,20+,21-;/m1./s1 |
| InChIKey | GMTYREVWZXJPLF-SXWPHCFWSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butorphanol tartrate (CHEBI:748229) is a phenanthrenes (CHEBI:25961) |
| Synonyms | Source |
|---|---|
| Butorphanol tartrate civ | ChEMBL |
| Dolorex | ChEMBL |
| LEVO-BC-2627 TARTRATE | ChEMBL |
| Moradol | ChEMBL |
| Torbugesic | ChEMBL |
| Torbutrol | ChEMBL |
| Brand Names | Source |
|---|---|
| Butorphanol tartrate preservative free | ChEMBL |
| Stadol | ChEMBL |
| Stadol ns | ChEMBL |
| Stadol preservative free | ChEMBL |
| Citations |
|---|