EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748223 - s-3304
| Formula | C24H20N2O4S2 |
| Net Charge | 0 |
| Average Mass | 464.568 |
| Monoisotopic Mass | 464.08645 |
| SMILES | Cc1ccc(C#Cc2ccc(S(=O)(=O)N[C@H](Cc3cnc4ccccc34)C(=O)O)s2)cc1 |
| InChI | InChI=1S/C24H20N2O4S2/c1-16-6-8-17(9-7-16)10-11-19-12-13-23(31-19)32(29,30)26-22(24(27)28)14-18-15-25-21-5-3-2-4-20(18)21/h2-9,12-13,15,22,25-26H,14H2,1H3,(H,27,28)/t22-/m1/s1 |
| InChIKey | YWCLDDLVLSQGSZ-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| s-3304 (CHEBI:748223) has role antineoplastic agent (CHEBI:35610) |
| s-3304 (CHEBI:748223) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| S 3304 | ChEMBL |
| S-3304 | ChEMBL |
| Citations |
|---|