EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H21ClFN3O2 |
| Net Charge | 0 |
| Average Mass | 473.935 |
| Monoisotopic Mass | 473.13063 |
| SMILES | Cc1ccc(F)cc1C(=O)Nc1ccc(C(=O)N2Cc3cccn3Cc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C27H21ClFN3O2/c1-17-8-9-19(29)13-23(17)26(33)30-20-10-11-22(24(28)14-20)27(34)32-16-21-6-4-12-31(21)15-18-5-2-3-7-25(18)32/h2-14H,15-16H2,1H3,(H,30,33) |
| InChIKey | PPHTXRNHTVLQED-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lixivaptan (CHEBI:748221) has role cardiovascular drug (CHEBI:35554) |
| lixivaptan (CHEBI:748221) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| lixivaptan | WHO MedNet |
| Synonyms | Source |
|---|---|
| CRTX 080 | ChEMBL |
| CRTX-080 | ChEMBL |
| CRTX080 | ChEMBL |
| VPA 985 | ChEMBL |
| VPA-985 | ChEMBL |
| VPA985 | ChEMBL |
| Brand Name | Source |
|---|---|
| Lixar | ChEMBL |
| Citations |
|---|