EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17FN2O3 |
| Net Charge | 0 |
| Average Mass | 280.299 |
| Monoisotopic Mass | 280.12232 |
| SMILES | CC[C@H]1C(=O)Nc2ccc(F)cc2N1C(=O)OC(C)C |
| InChI | InChI=1S/C14H17FN2O3/c1-4-11-13(18)16-10-6-5-9(15)7-12(10)17(11)14(19)20-8(2)3/h5-8,11H,4H2,1-3H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | KELNNWMENBUHNS-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| opaviraline (CHEBI:748219) is a α-amino acid (CHEBI:33704) |
| INNs | Source |
|---|---|
| opaviralina | WHO MedNet |
| opaviraline | WHO MedNet |
| Synonyms | Source |
|---|---|
| GW-420867 | ChEMBL |
| GW-420867X | ChEMBL |
| HBY-1293 | ChEMBL |
| Citations |
|---|