EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748215 - pirmagrel
| Formula | C13H16N2O2 |
| Net Charge | 0 |
| Average Mass | 232.283 |
| Monoisotopic Mass | 232.12118 |
| SMILES | O=C(O)CCCCCc1cccc2cncn12 |
| InChI | InChI=1S/C13H16N2O2/c16-13(17)8-3-1-2-5-11-6-4-7-12-9-14-10-15(11)12/h4,6-7,9-10H,1-3,5,8H2,(H,16,17) |
| InChIKey | LIFOFTJHFFTNRV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirmagrel (CHEBI:748215) is a medium-chain fatty acid (CHEBI:59554) |
| INN | Source |
|---|---|
| pirmagrel | WHO MedNet |
| Synonyms | Source |
|---|---|
| CGS 13080 | ChEMBL |
| CGS-13080 | ChEMBL |
| Citations |
|---|