EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H26N4O4 |
| Net Charge | 0 |
| Average Mass | 446.507 |
| Monoisotopic Mass | 446.19541 |
| SMILES | COC(=O)[C@H](Cc1cccc(C(=N)N)c1)[C@@H](C)NC(=O)c1ccc(-c2cc[n+]([O-])cc2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-16(22(25(31)33-2)15-17-4-3-5-21(14-17)23(26)27)28-24(30)20-8-6-18(7-9-20)19-10-12-29(32)13-11-19/h3-14,16,22H,15H2,1-2H3,(H3,26,27)(H,28,30)/t16-,22-/m1/s1 |
| InChIKey | PFGVNLZDWRZPJW-OPAMFIHVSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| otamixaban (CHEBI:748205) has functional parent β-amino acid (CHEBI:33706) |
| otamixaban (CHEBI:748205) has role cardiovascular drug (CHEBI:35554) |
| otamixaban (CHEBI:748205) has role renoprotective agent (CHEBI:231911) |
| otamixaban (CHEBI:748205) is a organonitrogen compound (CHEBI:35352) |
| otamixaban (CHEBI:748205) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| otamixaban | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fxv673 | ChEMBL |
| FXV-673 | ChEMBL |
| RPR-130673 | ChEMBL |
| RPR130673 | ChEMBL |
| XRP-0673 | ChEMBL |
| XRP0673 | ChEMBL |
| Citations |
|---|