EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748202 - carocainide
| Formula | C18H25N3O5 |
| Net Charge | 0 |
| Average Mass | 363.414 |
| Monoisotopic Mass | 363.17942 |
| SMILES | CNC(=O)Nc1c(OCCN2CCCC2)c(OC)c2occc2c1OC |
| InChI | InChI=1S/C18H25N3O5/c1-19-18(22)20-13-14(23-2)12-6-10-25-15(12)17(24-3)16(13)26-11-9-21-7-4-5-8-21/h6,10H,4-5,7-9,11H2,1-3H3,(H2,19,20,22) |
| InChIKey | BWMMRMDCODVQBX-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carocainide (CHEBI:748202) is a benzofurans (CHEBI:35259) |
| INNs | Source |
|---|---|
| carocainida | WHO MedNet |
| carocainide | WHO MedNet |
| Citations |
|---|