EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N2O4 |
| Net Charge | 0 |
| Average Mass | 202.210 |
| Monoisotopic Mass | 202.09536 |
| SMILES | N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C8H14N2O4/c9-5(4-11)7(12)10-3-1-2-6(10)8(13)14/h5-6,11H,1-4,9H2,(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | WBAXJMCUFIXCNI-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Pro (CHEBI:74820) has role metabolite (CHEBI:25212) |
| Ser-Pro (CHEBI:74820) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-seryl-L-proline |
| Synonyms | Source |
|---|---|
| serylproline | ChEBI |
| L-Ser-L-Pro | ChEBI |
| SP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029047 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15214 | Reaxys |