EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4N4O2 |
| Net Charge | 0 |
| Average Mass | 152.113 |
| Monoisotopic Mass | 152.03343 |
| SMILES | Oc1nc(O)c2cnnc2n1 |
| InChI | InChI=1S/C5H4N4O2/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | HXNFUBHNUDHIGC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxypurinol (CHEBI:748196) has role anti-anaemic agent (CHEBI:75835) |
| oxypurinol (CHEBI:748196) has role cardiovascular drug (CHEBI:35554) |
| oxypurinol (CHEBI:748196) is a pyrazolopyrimidine (CHEBI:38669) |
| Synonym | Source |
|---|---|
| NSC-76239 | ChEMBL |
| Citations |
|---|