EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32N2O3 |
| Net Charge | 0 |
| Average Mass | 456.586 |
| Monoisotopic Mass | 456.24129 |
| SMILES | Cc1c(-c2ccc(O)cc2)n(Cc2ccc(OCCN3CCCCC3)cc2)c2ccc(O)cc12 |
| InChI | InChI=1S/C29H32N2O3/c1-21-27-19-25(33)11-14-28(27)31(29(21)23-7-9-24(32)10-8-23)20-22-5-12-26(13-6-22)34-18-17-30-15-3-2-4-16-30/h5-14,19,32-33H,2-4,15-18,20H2,1H3 |
| InChIKey | JICOGKJOQXTAIP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pipendoxifene (CHEBI:748195) has role antineoplastic agent (CHEBI:35610) |
| pipendoxifene (CHEBI:748195) is a indoles (CHEBI:24828) |
| INNs | Source |
|---|---|
| pipendoxifene | WHO MedNet |
| pipendoxifeno | WHO MedNet |
| Synonym | Source |
|---|---|
| ERA-923 | ChEMBL |
| Citations |
|---|