EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:748183 - lodinixil
| Formula | C14H17ClN4 |
| Net Charge | 0 |
| Average Mass | 276.771 |
| Monoisotopic Mass | 276.11417 |
| SMILES | Cc1cccc(Nc2cc(Cl)nc(N(C)C)n2)c1C |
| InChI | InChI=1S/C14H17ClN4/c1-9-6-5-7-11(10(9)2)16-13-8-12(15)17-14(18-13)19(3)4/h5-8H,1-4H3,(H,16,17,18) |
| InChIKey | GMMWNTHAIOJBSD-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lodinixil (CHEBI:748183) is a methylbenzene (CHEBI:38975) |
| INNs | Source |
|---|---|
| lodinixil | WHO MedNet |
| lodinixilo | WHO MedNet |
| Citations |
|---|